C11H11ClN4S2 — CID 102668557
3-chloro-4-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]benzenecarboximidamide (PubChem CID 102668557) has the molecular formula C11H11ClN4S2 and a molecular weight of 298.82 g/mol. Its IUPAC name is 3-chloro-4-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]benzenecarboximidamide.
| Compound Name | 3-chloro-4-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 102668557 |
| Molecular Formula | C11H11ClN4S2 |
| Molecular Weight | 298.82 g/mol |
| Exact Mass | 298.01 |
| IUPAC Name | 3-chloro-4-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(CSc2nnc(C)s2)c(Cl)c1 |
| InChI | InChI=1S/C11H11ClN4S2/c1-6-15-16-11(18-6)17-5-8-3-2-7(10(13)14)4-9(8)12/h2-4H,5H2,1H3,(H3,13,14) |
| InChIKey | MXZVANVUORTAMZ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 75.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.82 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|