C17H17ClN2S — CID 102668545
3-chloro-4-(2,3-dihydro-1H-inden-5-ylsulfanylmethyl)benzenecarboximidamide (PubChem CID 102668545) has the molecular formula C17H17ClN2S and a molecular weight of 316.86 g/mol. Its IUPAC name is 3-chloro-4-(2,3-dihydro-1H-inden-5-ylsulfanylmethyl)benzenecarboximidamide.
| Compound Name | 3-chloro-4-(2,3-dihydro-1H-inden-5-ylsulfanylmethyl)benzenecarboximidamide |
|---|---|
| PubChem CID | 102668545 |
| Molecular Formula | C17H17ClN2S |
| Molecular Weight | 316.86 g/mol |
| Exact Mass | 316.08 |
| IUPAC Name | 3-chloro-4-(2,3-dihydro-1H-inden-5-ylsulfanylmethyl)benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(CSc2ccc3c(c2)CCC3)c(Cl)c1 |
| InChI | InChI=1S/C17H17ClN2S/c18-16-9-13(17(19)20)4-5-14(16)10-21-15-7-6-11-2-1-3-12(11)8-15/h4-9H,1-3,10H2,(H3,19,20) |
| InChIKey | XDNJIFKRUVBSCR-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.86 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|