C14H11F3N2S — CID 43345183
4-[(3,4-difluorophenyl)sulfanylmethyl]-3-fluorobenzenecarboximidamide (PubChem CID 43345183) has the molecular formula C14H11F3N2S and a molecular weight of 296.32 g/mol. Its IUPAC name is 4-[(3,4-difluorophenyl)sulfanylmethyl]-3-fluorobenzenecarboximidamide.
| Compound Name | 4-[(3,4-difluorophenyl)sulfanylmethyl]-3-fluorobenzenecarboximidamide |
|---|---|
| PubChem CID | 43345183 |
| Molecular Formula | C14H11F3N2S |
| Molecular Weight | 296.32 g/mol |
| Exact Mass | 296.06 |
| IUPAC Name | 4-[(3,4-difluorophenyl)sulfanylmethyl]-3-fluorobenzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(CSc2ccc(F)c(F)c2)c(F)c1 |
| InChI | InChI=1S/C14H11F3N2S/c15-11-4-3-10(6-13(11)17)20-7-9-2-1-8(14(18)19)5-12(9)16/h1-6H,7H2,(H3,18,19) |
| InChIKey | QDDICNWDOIKJHX-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.32 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|