C15H12FN3S2 — CID 28556815
4-(1,3-benzothiazol-2-ylsulfanylmethyl)-3-fluorobenzenecarboximidamide (PubChem CID 28556815) has the molecular formula C15H12FN3S2 and a molecular weight of 317.41 g/mol. Its IUPAC name is 4-(1,3-benzothiazol-2-ylsulfanylmethyl)-3-fluorobenzenecarboximidamide.
| Compound Name | 4-(1,3-benzothiazol-2-ylsulfanylmethyl)-3-fluorobenzenecarboximidamide |
|---|---|
| PubChem CID | 28556815 |
| Molecular Formula | C15H12FN3S2 |
| Molecular Weight | 317.41 g/mol |
| Exact Mass | 317.05 |
| IUPAC Name | 4-(1,3-benzothiazol-2-ylsulfanylmethyl)-3-fluorobenzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(CSc2nc3ccccc3s2)c(F)c1 |
| InChI | InChI=1S/C15H12FN3S2/c16-11-7-9(14(17)18)5-6-10(11)8-20-15-19-12-3-1-2-4-13(12)21-15/h1-7H,8H2,(H3,17,18) |
| InChIKey | SAGCKNAGCUHUOK-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 62.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.41 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|