C9H9N3OS2 — CID 67593162
1,3-benzothiazol-2-ylsulfanylmethylurea (PubChem CID 67593162) has the molecular formula C9H9N3OS2 and a molecular weight of 239.33 g/mol. Its IUPAC name is 1,3-benzothiazol-2-ylsulfanylmethylurea.
| Compound Name | 1,3-benzothiazol-2-ylsulfanylmethylurea |
|---|---|
| PubChem CID | 67593162 |
| Molecular Formula | C9H9N3OS2 |
| Molecular Weight | 239.33 g/mol |
| Exact Mass | 239.02 |
| IUPAC Name | 1,3-benzothiazol-2-ylsulfanylmethylurea |
| SMILES | NC(=O)NCSc1nc2ccccc2s1 |
| InChI | InChI=1S/C9H9N3OS2/c10-8(13)11-5-14-9-12-6-3-1-2-4-7(6)15-9/h1-4H,5H2,(H3,10,11,13) |
| InChIKey | ZWZRFZPYMFULPP-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.33 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|