C13H11N3O2S2 — CID 63581701
5-(1,3-benzothiazol-2-ylsulfanylmethyl)furan-3-carbohydrazide (PubChem CID 63581701) has the molecular formula C13H11N3O2S2 and a molecular weight of 305.38 g/mol. Its IUPAC name is 5-(1,3-benzothiazol-2-ylsulfanylmethyl)furan-3-carbohydrazide.
| Compound Name | 5-(1,3-benzothiazol-2-ylsulfanylmethyl)furan-3-carbohydrazide |
|---|---|
| PubChem CID | 63581701 |
| Molecular Formula | C13H11N3O2S2 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.03 |
| IUPAC Name | 5-(1,3-benzothiazol-2-ylsulfanylmethyl)furan-3-carbohydrazide |
| SMILES | NNC(=O)c1coc(CSc2nc3ccccc3s2)c1 |
| InChI | InChI=1S/C13H11N3O2S2/c14-16-12(17)8-5-9(18-6-8)7-19-13-15-10-3-1-2-4-11(10)20-13/h1-6H,7,14H2,(H,16,17) |
| InChIKey | MCSMTKAIHAKCSP-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 81.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|