C12H12N6OS2 — CID 63582067
1-[2-(1,3-benzothiazol-2-ylsulfanyl)ethyl]triazole-4-carbohydrazide (PubChem CID 63582067) has the molecular formula C12H12N6OS2 and a molecular weight of 320.40 g/mol. Its IUPAC name is 1-[2-(1,3-benzothiazol-2-ylsulfanyl)ethyl]triazole-4-carbohydrazide.
| Compound Name | 1-[2-(1,3-benzothiazol-2-ylsulfanyl)ethyl]triazole-4-carbohydrazide |
|---|---|
| PubChem CID | 63582067 |
| Molecular Formula | C12H12N6OS2 |
| Molecular Weight | 320.40 g/mol |
| Exact Mass | 320.05 |
| IUPAC Name | 1-[2-(1,3-benzothiazol-2-ylsulfanyl)ethyl]triazole-4-carbohydrazide |
| SMILES | NNC(=O)c1cn(CCSc2nc3ccccc3s2)nn1 |
| InChI | InChI=1S/C12H12N6OS2/c13-15-11(19)9-7-18(17-16-9)5-6-20-12-14-8-3-1-2-4-10(8)21-12/h1-4,7H,5-6,13H2,(H,15,19) |
| InChIKey | SXAQMXIEVQOMQU-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 98.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.40 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|