C11H13ClN6OS — CID 79528117
1-[2-(2-amino-5-chlorophenyl)sulfanylethyl]triazole-4-carbohydrazide (PubChem CID 79528117) has the molecular formula C11H13ClN6OS and a molecular weight of 312.79 g/mol. Its IUPAC name is 1-[2-(2-amino-5-chlorophenyl)sulfanylethyl]triazole-4-carbohydrazide.
| Compound Name | 1-[2-(2-amino-5-chlorophenyl)sulfanylethyl]triazole-4-carbohydrazide |
|---|---|
| PubChem CID | 79528117 |
| Molecular Formula | C11H13ClN6OS |
| Molecular Weight | 312.79 g/mol |
| Exact Mass | 312.06 |
| IUPAC Name | 1-[2-(2-amino-5-chlorophenyl)sulfanylethyl]triazole-4-carbohydrazide |
| SMILES | NNC(=O)c1cn(CCSc2cc(Cl)ccc2N)nn1 |
| InChI | InChI=1S/C11H13ClN6OS/c12-7-1-2-8(13)10(5-7)20-4-3-18-6-9(16-17-18)11(19)15-14/h1-2,5-6H,3-4,13-14H2,(H,15,19) |
| InChIKey | TWXKHTUTNMYLOM-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 111.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.79 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|