C11H12N4O2S — CID 61317412
1-[2-(2-aminophenyl)sulfanylethyl]triazole-4-carboxylic acid (PubChem CID 61317412) has the molecular formula C11H12N4O2S and a molecular weight of 264.31 g/mol. Its IUPAC name is 1-[2-(2-aminophenyl)sulfanylethyl]triazole-4-carboxylic acid.
| Compound Name | 1-[2-(2-aminophenyl)sulfanylethyl]triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 61317412 |
| Molecular Formula | C11H12N4O2S |
| Molecular Weight | 264.31 g/mol |
| Exact Mass | 264.07 |
| IUPAC Name | 1-[2-(2-aminophenyl)sulfanylethyl]triazole-4-carboxylic acid |
| SMILES | Nc1ccccc1SCCn1cc(C(=O)O)nn1 |
| InChI | InChI=1S/C11H12N4O2S/c12-8-3-1-2-4-10(8)18-6-5-15-7-9(11(16)17)13-14-15/h1-4,7H,5-6,12H2,(H,16,17) |
| InChIKey | UUPQKKNHAOBYPG-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 94.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.31 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|