C15H19N3O2S — CID 43330707
1-[2-(4-tert-butylphenyl)sulfanylethyl]triazole-4-carboxylic acid (PubChem CID 43330707) has the molecular formula C15H19N3O2S and a molecular weight of 305.40 g/mol. Its IUPAC name is 1-[2-(4-tert-butylphenyl)sulfanylethyl]triazole-4-carboxylic acid.
| Compound Name | 1-[2-(4-tert-butylphenyl)sulfanylethyl]triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 43330707 |
| Molecular Formula | C15H19N3O2S |
| Molecular Weight | 305.40 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | 1-[2-(4-tert-butylphenyl)sulfanylethyl]triazole-4-carboxylic acid |
| SMILES | CC(C)(C)c1ccc(SCCn2cc(C(=O)O)nn2)cc1 |
| InChI | InChI=1S/C15H19N3O2S/c1-15(2,3)11-4-6-12(7-5-11)21-9-8-18-10-13(14(19)20)16-17-18/h4-7,10H,8-9H2,1-3H3,(H,19,20) |
| InChIKey | NHXMVKPIBVYMGU-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.40 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |