C8H13N3O3S — CID 43445808
1-[2-(2-methoxyethylsulfanyl)ethyl]triazole-4-carboxylic acid (PubChem CID 43445808) has the molecular formula C8H13N3O3S and a molecular weight of 231.28 g/mol. Its IUPAC name is 1-[2-(2-methoxyethylsulfanyl)ethyl]triazole-4-carboxylic acid.
| Compound Name | 1-[2-(2-methoxyethylsulfanyl)ethyl]triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 43445808 |
| Molecular Formula | C8H13N3O3S |
| Molecular Weight | 231.28 g/mol |
| Exact Mass | 231.07 |
| IUPAC Name | 1-[2-(2-methoxyethylsulfanyl)ethyl]triazole-4-carboxylic acid |
| SMILES | COCCSCCn1cc(C(=O)O)nn1 |
| InChI | InChI=1S/C8H13N3O3S/c1-14-3-5-15-4-2-11-6-7(8(12)13)9-10-11/h6H,2-5H2,1H3,(H,12,13) |
| InChIKey | LFSGIGJMDLFGCV-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.28 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|