About 1-[2-(1,3-oxazol-2-ylsulfanyl)ethyl]triazole-4-carboxylic acid
1-[2-(1,3-oxazol-2-ylsulfanyl)ethyl]triazole-4-carboxylic acid (PubChem CID 106920719) has the molecular formula C8H8N4O3S
and a molecular weight of 240.24 g/mol. Its IUPAC name is 1-[2-(1,3-oxazol-2-ylsulfanyl)ethyl]triazole-4-carboxylic acid.
Analyze 1-[2-(1,3-oxazol-2-ylsulfanyl)ethyl]triazole-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(1,3-oxazol-2-ylsulfanyl)ethyl]triazole-4-carboxylic acid?
The IUPAC name of 1-[2-(1,3-oxazol-2-ylsulfanyl)ethyl]triazole-4-carboxylic acid (CID 106920719) is 1-[2-(1,3-oxazol-2-ylsulfanyl)ethyl]triazole-4-carboxylic acid.
What is the SMILES notation for 1-[2-(1,3-oxazol-2-ylsulfanyl)ethyl]triazole-4-carboxylic acid?
The canonical SMILES for 1-[2-(1,3-oxazol-2-ylsulfanyl)ethyl]triazole-4-carboxylic acid is O=C(O)c1cn(CCSc2ncco2)nn1.
What is the InChIKey of 1-[2-(1,3-oxazol-2-ylsulfanyl)ethyl]triazole-4-carboxylic acid?
The InChIKey is DTVIKSLXFRPUFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N4O3S/c13-7(14)6-5-12(11-10-6)2-4-16-8-9-1-3-15-8/h1,3,5H,2,4H2,(H,13,14).
What are the key properties of 1-[2-(1,3-oxazol-2-ylsulfanyl)ethyl]triazole-4-carboxylic acid?
1-[2-(1,3-oxazol-2-ylsulfanyl)ethyl]triazole-4-carboxylic acid has a molecular weight of 240.24 g/mol, XLogP of 0.76, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(1,3-oxazol-2-ylsulfanyl)ethyl]triazole-4-carboxylic acid is sourced from PubChem (CID 106920719), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).