C11H11FN4O2S — CID 79148763
1-[2-(2-amino-5-fluorophenyl)sulfanylethyl]triazole-4-carboxylic acid (PubChem CID 79148763) has the molecular formula C11H11FN4O2S and a molecular weight of 282.30 g/mol. Its IUPAC name is 1-[2-(2-amino-5-fluorophenyl)sulfanylethyl]triazole-4-carboxylic acid.
| Compound Name | 1-[2-(2-amino-5-fluorophenyl)sulfanylethyl]triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 79148763 |
| Molecular Formula | C11H11FN4O2S |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.06 |
| IUPAC Name | 1-[2-(2-amino-5-fluorophenyl)sulfanylethyl]triazole-4-carboxylic acid |
| SMILES | Nc1ccc(F)cc1SCCn1cc(C(=O)O)nn1 |
| InChI | InChI=1S/C11H11FN4O2S/c12-7-1-2-8(13)10(5-7)19-4-3-16-6-9(11(17)18)14-15-16/h1-2,5-6H,3-4,13H2,(H,17,18) |
| InChIKey | UZTYSLCGWVCLAO-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 94.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|