C11H9ClFN3O3 — CID 43345102
1-[2-(2-chloro-4-fluorophenoxy)ethyl]triazole-4-carboxylic acid (PubChem CID 43345102) has the molecular formula C11H9ClFN3O3 and a molecular weight of 285.66 g/mol. Its IUPAC name is 1-[2-(2-chloro-4-fluorophenoxy)ethyl]triazole-4-carboxylic acid.
| Compound Name | 1-[2-(2-chloro-4-fluorophenoxy)ethyl]triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 43345102 |
| Molecular Formula | C11H9ClFN3O3 |
| Molecular Weight | 285.66 g/mol |
| Exact Mass | 285.03 |
| IUPAC Name | 1-[2-(2-chloro-4-fluorophenoxy)ethyl]triazole-4-carboxylic acid |
| SMILES | O=C(O)c1cn(CCOc2ccc(F)cc2Cl)nn1 |
| InChI | InChI=1S/C11H9ClFN3O3/c12-8-5-7(13)1-2-10(8)19-4-3-16-6-9(11(17)18)14-15-16/h1-2,5-6H,3-4H2,(H,17,18) |
| InChIKey | CEPSEEXVMPLJAE-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.66 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |