C12H12ClN3O3 — CID 29082352
1-[2-(4-chloro-2-methylphenoxy)ethyl]triazole-4-carboxylic acid (PubChem CID 29082352) has the molecular formula C12H12ClN3O3 and a molecular weight of 281.70 g/mol. Its IUPAC name is 1-[2-(4-chloro-2-methylphenoxy)ethyl]triazole-4-carboxylic acid.
| Compound Name | 1-[2-(4-chloro-2-methylphenoxy)ethyl]triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 29082352 |
| Molecular Formula | C12H12ClN3O3 |
| Molecular Weight | 281.70 g/mol |
| Exact Mass | 281.06 |
| IUPAC Name | 1-[2-(4-chloro-2-methylphenoxy)ethyl]triazole-4-carboxylic acid |
| SMILES | Cc1cc(Cl)ccc1OCCn1cc(C(=O)O)nn1 |
| InChI | InChI=1S/C12H12ClN3O3/c1-8-6-9(13)2-3-11(8)19-5-4-16-7-10(12(17)18)14-15-16/h2-3,6-7H,4-5H2,1H3,(H,17,18) |
| InChIKey | RNUWVNFGQXJJKX-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.70 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |