C12H12N4O4 — CID 29082468
1-[2-(3-carbamoylphenoxy)ethyl]triazole-4-carboxylic acid (PubChem CID 29082468) has the molecular formula C12H12N4O4 and a molecular weight of 276.25 g/mol. Its IUPAC name is 1-[2-(3-carbamoylphenoxy)ethyl]triazole-4-carboxylic acid.
| Compound Name | 1-[2-(3-carbamoylphenoxy)ethyl]triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 29082468 |
| Molecular Formula | C12H12N4O4 |
| Molecular Weight | 276.25 g/mol |
| Exact Mass | 276.09 |
| IUPAC Name | 1-[2-(3-carbamoylphenoxy)ethyl]triazole-4-carboxylic acid |
| SMILES | NC(=O)c1cccc(OCCn2cc(C(=O)O)nn2)c1 |
| InChI | InChI=1S/C12H12N4O4/c13-11(17)8-2-1-3-9(6-8)20-5-4-16-7-10(12(18)19)14-15-16/h1-3,6-7H,4-5H2,(H2,13,17)(H,18,19) |
| InChIKey | VHQOHAXLSBHNLM-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 120.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.25 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |