C12H12N4O5 — CID 29082394
1-[2-(3-methyl-4-nitrophenoxy)ethyl]triazole-4-carboxylic acid (PubChem CID 29082394) has the molecular formula C12H12N4O5 and a molecular weight of 292.25 g/mol. Its IUPAC name is 1-[2-(3-methyl-4-nitrophenoxy)ethyl]triazole-4-carboxylic acid.
| Compound Name | 1-[2-(3-methyl-4-nitrophenoxy)ethyl]triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 29082394 |
| Molecular Formula | C12H12N4O5 |
| Molecular Weight | 292.25 g/mol |
| Exact Mass | 292.08 |
| IUPAC Name | 1-[2-(3-methyl-4-nitrophenoxy)ethyl]triazole-4-carboxylic acid |
| SMILES | Cc1cc(OCCn2cc(C(=O)O)nn2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H12N4O5/c1-8-6-9(2-3-11(8)16(19)20)21-5-4-15-7-10(12(17)18)13-14-15/h2-3,6-7H,4-5H2,1H3,(H,17,18) |
| InChIKey | ISSKTHRXLJAZQQ-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 120.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.25 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|