C11H9Cl2FN4O2 — CID 107575633
1-[2-(3,5-dichloro-4-fluoroanilino)ethyl]triazole-4-carboxylic acid (PubChem CID 107575633) has the molecular formula C11H9Cl2FN4O2 and a molecular weight of 319.12 g/mol. Its IUPAC name is 1-[2-(3,5-dichloro-4-fluoroanilino)ethyl]triazole-4-carboxylic acid.
| Compound Name | 1-[2-(3,5-dichloro-4-fluoroanilino)ethyl]triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 107575633 |
| Molecular Formula | C11H9Cl2FN4O2 |
| Molecular Weight | 319.12 g/mol |
| Exact Mass | 318.01 |
| IUPAC Name | 1-[2-(3,5-dichloro-4-fluoroanilino)ethyl]triazole-4-carboxylic acid |
| SMILES | O=C(O)c1cn(CCNc2cc(Cl)c(F)c(Cl)c2)nn1 |
| InChI | InChI=1S/C11H9Cl2FN4O2/c12-7-3-6(4-8(13)10(7)14)15-1-2-18-5-9(11(19)20)16-17-18/h3-5,15H,1-2H2,(H,19,20) |
| InChIKey | SDKSZHSYSHGWQC-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.12 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|