C12H15N5O3 — CID 103257266
1-[2-[(6-ethoxy-3-pyridinyl)amino]ethyl]triazole-4-carboxylic acid (PubChem CID 103257266) has the molecular formula C12H15N5O3 and a molecular weight of 277.28 g/mol. Its IUPAC name is 1-[2-[(6-ethoxy-3-pyridinyl)amino]ethyl]triazole-4-carboxylic acid.
| Compound Name | 1-[2-[(6-ethoxy-3-pyridinyl)amino]ethyl]triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 103257266 |
| Molecular Formula | C12H15N5O3 |
| Molecular Weight | 277.28 g/mol |
| Exact Mass | 277.12 |
| IUPAC Name | 1-[2-[(6-ethoxy-3-pyridinyl)amino]ethyl]triazole-4-carboxylic acid |
| SMILES | CCOc1ccc(NCCn2cc(C(=O)O)nn2)cn1 |
| InChI | InChI=1S/C12H15N5O3/c1-2-20-11-4-3-9(7-14-11)13-5-6-17-8-10(12(18)19)15-16-17/h3-4,7-8,13H,2,5-6H2,1H3,(H,18,19) |
| InChIKey | GPAYWAAFDQLAQX-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 102.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.28 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |