C12H16N6O3 — CID 66332703
1-[2-[(6-ethoxy-2-methylpyrimidin-4-yl)amino]ethyl]triazole-4-carboxylic acid (PubChem CID 66332703) has the molecular formula C12H16N6O3 and a molecular weight of 292.30 g/mol. Its IUPAC name is 1-[2-[(6-ethoxy-2-methylpyrimidin-4-yl)amino]ethyl]triazole-4-carboxylic acid.
| Compound Name | 1-[2-[(6-ethoxy-2-methylpyrimidin-4-yl)amino]ethyl]triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 66332703 |
| Molecular Formula | C12H16N6O3 |
| Molecular Weight | 292.30 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | 1-[2-[(6-ethoxy-2-methylpyrimidin-4-yl)amino]ethyl]triazole-4-carboxylic acid |
| SMILES | CCOc1cc(NCCn2cc(C(=O)O)nn2)nc(C)n1 |
| InChI | InChI=1S/C12H16N6O3/c1-3-21-11-6-10(14-8(2)15-11)13-4-5-18-7-9(12(19)20)16-17-18/h6-7H,3-5H2,1-2H3,(H,19,20)(H,13,14,15) |
| InChIKey | QIHYYGNDLZQHSI-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 115.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.30 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |