C11H16N6O2 — CID 107463799
1-[2-[(3-ethyl-1-methylpyrazol-4-yl)amino]ethyl]triazole-4-carboxylic acid (PubChem CID 107463799) has the molecular formula C11H16N6O2 and a molecular weight of 264.29 g/mol. Its IUPAC name is 1-[2-[(3-ethyl-1-methylpyrazol-4-yl)amino]ethyl]triazole-4-carboxylic acid.
| Compound Name | 1-[2-[(3-ethyl-1-methylpyrazol-4-yl)amino]ethyl]triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 107463799 |
| Molecular Formula | C11H16N6O2 |
| Molecular Weight | 264.29 g/mol |
| Exact Mass | 264.13 |
| IUPAC Name | 1-[2-[(3-ethyl-1-methylpyrazol-4-yl)amino]ethyl]triazole-4-carboxylic acid |
| SMILES | CCc1nn(C)cc1NCCn1cc(C(=O)O)nn1 |
| InChI | InChI=1S/C11H16N6O2/c1-3-8-9(6-16(2)14-8)12-4-5-17-7-10(11(18)19)13-15-17/h6-7,12H,3-5H2,1-2H3,(H,18,19) |
| InChIKey | KOKFMPIVIOQNPF-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 97.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.29 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |