C11H20N4O3 — CID 103249079
1-[2-[3-(hydroxymethyl)pentan-3-ylamino]ethyl]triazole-4-carboxylic acid (PubChem CID 103249079) has the molecular formula C11H20N4O3 and a molecular weight of 256.31 g/mol. Its IUPAC name is 1-[2-[3-(hydroxymethyl)pentan-3-ylamino]ethyl]triazole-4-carboxylic acid.
| Compound Name | 1-[2-[3-(hydroxymethyl)pentan-3-ylamino]ethyl]triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 103249079 |
| Molecular Formula | C11H20N4O3 |
| Molecular Weight | 256.31 g/mol |
| Exact Mass | 256.15 |
| IUPAC Name | 1-[2-[3-(hydroxymethyl)pentan-3-ylamino]ethyl]triazole-4-carboxylic acid |
| SMILES | CCC(CC)(CO)NCCn1cc(C(=O)O)nn1 |
| InChI | InChI=1S/C11H20N4O3/c1-3-11(4-2,8-16)12-5-6-15-7-9(10(17)18)13-14-15/h7,12,16H,3-6,8H2,1-2H3,(H,17,18) |
| InChIKey | XYMFGVPMVPFBCQ-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 100.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.31 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |