C10H18N4O3 — CID 103256503
1-[2-[(1-hydroxy-3-methylbutan-2-yl)amino]ethyl]triazole-4-carboxylic acid (PubChem CID 103256503) has the molecular formula C10H18N4O3 and a molecular weight of 242.28 g/mol. Its IUPAC name is 1-[2-[(1-hydroxy-3-methylbutan-2-yl)amino]ethyl]triazole-4-carboxylic acid.
| Compound Name | 1-[2-[(1-hydroxy-3-methylbutan-2-yl)amino]ethyl]triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 103256503 |
| Molecular Formula | C10H18N4O3 |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.14 |
| IUPAC Name | 1-[2-[(1-hydroxy-3-methylbutan-2-yl)amino]ethyl]triazole-4-carboxylic acid |
| SMILES | CC(C)C(CO)NCCn1cc(C(=O)O)nn1 |
| InChI | InChI=1S/C10H18N4O3/c1-7(2)9(6-15)11-3-4-14-5-8(10(16)17)12-13-14/h5,7,9,11,15H,3-4,6H2,1-2H3,(H,16,17) |
| InChIKey | JSJOJMNYRIKHEP-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 100.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |