C12H16N4O2S — CID 103246680
1-[2-[1-(5-methylthiophen-2-yl)ethylamino]ethyl]triazole-4-carboxylic acid (PubChem CID 103246680) has the molecular formula C12H16N4O2S and a molecular weight of 280.35 g/mol. Its IUPAC name is 1-[2-[1-(5-methylthiophen-2-yl)ethylamino]ethyl]triazole-4-carboxylic acid.
| Compound Name | 1-[2-[1-(5-methylthiophen-2-yl)ethylamino]ethyl]triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 103246680 |
| Molecular Formula | C12H16N4O2S |
| Molecular Weight | 280.35 g/mol |
| Exact Mass | 280.10 |
| IUPAC Name | 1-[2-[1-(5-methylthiophen-2-yl)ethylamino]ethyl]triazole-4-carboxylic acid |
| SMILES | Cc1ccc(C(C)NCCn2cc(C(=O)O)nn2)s1 |
| InChI | InChI=1S/C12H16N4O2S/c1-8-3-4-11(19-8)9(2)13-5-6-16-7-10(12(17)18)14-15-16/h3-4,7,9,13H,5-6H2,1-2H3,(H,17,18) |
| InChIKey | IJZDBZYZYNVHHB-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.35 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |