C10H18N4O2S — CID 103265843
1-[2-(4-methylsulfanylbutan-2-ylamino)ethyl]triazole-4-carboxylic acid (PubChem CID 103265843) has the molecular formula C10H18N4O2S and a molecular weight of 258.35 g/mol. Its IUPAC name is 1-[2-(4-methylsulfanylbutan-2-ylamino)ethyl]triazole-4-carboxylic acid.
| Compound Name | 1-[2-(4-methylsulfanylbutan-2-ylamino)ethyl]triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 103265843 |
| Molecular Formula | C10H18N4O2S |
| Molecular Weight | 258.35 g/mol |
| Exact Mass | 258.12 |
| IUPAC Name | 1-[2-(4-methylsulfanylbutan-2-ylamino)ethyl]triazole-4-carboxylic acid |
| SMILES | CSCCC(C)NCCn1cc(C(=O)O)nn1 |
| InChI | InChI=1S/C10H18N4O2S/c1-8(3-6-17-2)11-4-5-14-7-9(10(15)16)12-13-14/h7-8,11H,3-6H2,1-2H3,(H,15,16) |
| InChIKey | SMVRQTBMMXRYMK-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.35 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |