C8H15N5O4S — CID 114806464
1-[2-(propan-2-ylsulfamoylamino)ethyl]triazole-4-carboxylic acid (PubChem CID 114806464) has the molecular formula C8H15N5O4S and a molecular weight of 277.31 g/mol. Its IUPAC name is 1-[2-(propan-2-ylsulfamoylamino)ethyl]triazole-4-carboxylic acid.
| Compound Name | 1-[2-(propan-2-ylsulfamoylamino)ethyl]triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 114806464 |
| Molecular Formula | C8H15N5O4S |
| Molecular Weight | 277.31 g/mol |
| Exact Mass | 277.08 |
| IUPAC Name | 1-[2-(propan-2-ylsulfamoylamino)ethyl]triazole-4-carboxylic acid |
| SMILES | CC(C)NS(=O)(=O)NCCn1cc(C(=O)O)nn1 |
| InChI | InChI=1S/C8H15N5O4S/c1-6(2)11-18(16,17)9-3-4-13-5-7(8(14)15)10-12-13/h5-6,9,11H,3-4H2,1-2H3,(H,14,15) |
| InChIKey | XEACNEUHMNFIFS-UHFFFAOYSA-N |
| XLogP | -1.19 |
| TPSA | 126.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.31 |
| LogP ≤ 5 | -1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |