About 1-[2-[(2,3-dihydroxy-2-methylpropyl)amino]ethyl]triazole-4-carboxylic acid
1-[2-[(2,3-dihydroxy-2-methylpropyl)amino]ethyl]triazole-4-carboxylic acid (PubChem CID 103255983) has the molecular formula C9H16N4O4
and a molecular weight of 244.25 g/mol. Its IUPAC name is 1-[2-[(2,3-dihydroxy-2-methylpropyl)amino]ethyl]triazole-4-carboxylic acid.
Molecular Properties
| Compound Name | 1-[2-[(2,3-dihydroxy-2-methylpropyl)amino]ethyl]triazole-4-carboxylic acid |
| PubChem CID | 103255983 |
| Molecular Formula | C9H16N4O4 |
| Molecular Weight | 244.25 g/mol |
| Exact Mass | 244.12 |
| IUPAC Name | 1-[2-[(2,3-dihydroxy-2-methylpropyl)amino]ethyl]triazole-4-carboxylic acid |
| SMILES | CC(O)(CO)CNCCn1cc(C(=O)O)nn1 |
| InChI | InChI=1S/C9H16N4O4/c1-9(17,6-14)5-10-2-3-13-4-7(8(15)16)11-12-13/h4,10,14,17H,2-3,5-6H2,1H3,(H,15,16) |
| InChIKey | WKXKGIGNJWZKRC-UHFFFAOYSA-N |
| XLogP | -1.69 |
| TPSA | 120.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.25 |
| LogP ≤ 5 | -1.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-[2-[(2,3-dihydroxy-2-methylpropyl)amino]ethyl]triazole-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-[(2,3-dihydroxy-2-methylpropyl)amino]ethyl]triazole-4-carboxylic acid?
The IUPAC name of 1-[2-[(2,3-dihydroxy-2-methylpropyl)amino]ethyl]triazole-4-carboxylic acid (CID 103255983) is 1-[2-[(2,3-dihydroxy-2-methylpropyl)amino]ethyl]triazole-4-carboxylic acid.
What is the SMILES notation for 1-[2-[(2,3-dihydroxy-2-methylpropyl)amino]ethyl]triazole-4-carboxylic acid?
The canonical SMILES for 1-[2-[(2,3-dihydroxy-2-methylpropyl)amino]ethyl]triazole-4-carboxylic acid is CC(O)(CO)CNCCn1cc(C(=O)O)nn1.
What is the InChIKey of 1-[2-[(2,3-dihydroxy-2-methylpropyl)amino]ethyl]triazole-4-carboxylic acid?
The InChIKey is WKXKGIGNJWZKRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N4O4/c1-9(17,6-14)5-10-2-3-13-4-7(8(15)16)11-12-13/h4,10,14,17H,2-3,5-6H2,1H3,(H,15,16).
What are the key properties of 1-[2-[(2,3-dihydroxy-2-methylpropyl)amino]ethyl]triazole-4-carboxylic acid?
1-[2-[(2,3-dihydroxy-2-methylpropyl)amino]ethyl]triazole-4-carboxylic acid has a molecular weight of 244.25 g/mol, XLogP of -1.69, 7 rotatable bonds, 4 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-[(2,3-dihydroxy-2-methylpropyl)amino]ethyl]triazole-4-carboxylic acid is sourced from PubChem (CID 103255983), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).