C9H16N4O4 — CID 103255983
1-[2-[(2,3-dihydroxy-2-methylpropyl)amino]ethyl]triazole-4-carboxylic acid (PubChem CID 103255983) has the molecular formula C9H16N4O4 and a molecular weight of 244.25 g/mol. Its IUPAC name is 1-[2-[(2,3-dihydroxy-2-methylpropyl)amino]ethyl]triazole-4-carboxylic acid.
| Compound Name | 1-[2-[(2,3-dihydroxy-2-methylpropyl)amino]ethyl]triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 103255983 |
| Molecular Formula | C9H16N4O4 |
| Molecular Weight | 244.25 g/mol |
| Exact Mass | 244.12 |
| IUPAC Name | 1-[2-[(2,3-dihydroxy-2-methylpropyl)amino]ethyl]triazole-4-carboxylic acid |
| SMILES | CC(O)(CO)CNCCn1cc(C(=O)O)nn1 |
| InChI | InChI=1S/C9H16N4O4/c1-9(17,6-14)5-10-2-3-13-4-7(8(15)16)11-12-13/h4,10,14,17H,2-3,5-6H2,1H3,(H,15,16) |
| InChIKey | WKXKGIGNJWZKRC-UHFFFAOYSA-N |
| XLogP | -1.69 |
| TPSA | 120.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.25 |
| LogP ≤ 5 | -1.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|