C9H18N6OS — CID 66234837
1-[2-(3-aminobutylsulfanyl)ethyl]triazole-4-carbohydrazide (PubChem CID 66234837) has the molecular formula C9H18N6OS and a molecular weight of 258.35 g/mol. Its IUPAC name is 1-[2-(3-aminobutylsulfanyl)ethyl]triazole-4-carbohydrazide.
| Compound Name | 1-[2-(3-aminobutylsulfanyl)ethyl]triazole-4-carbohydrazide |
|---|---|
| PubChem CID | 66234837 |
| Molecular Formula | C9H18N6OS |
| Molecular Weight | 258.35 g/mol |
| Exact Mass | 258.13 |
| IUPAC Name | 1-[2-(3-aminobutylsulfanyl)ethyl]triazole-4-carbohydrazide |
| SMILES | CC(N)CCSCCn1cc(C(=O)NN)nn1 |
| InChI | InChI=1S/C9H18N6OS/c1-7(10)2-4-17-5-3-15-6-8(13-14-15)9(16)12-11/h6-7H,2-5,10-11H2,1H3,(H,12,16) |
| InChIKey | JLUYREHYLXFECT-UHFFFAOYSA-N |
| XLogP | -0.65 |
| TPSA | 111.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.35 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|