C9H13N7OS — CID 63581139
1-[2-(1-methylimidazol-2-yl)sulfanylethyl]triazole-4-carbohydrazide (PubChem CID 63581139) has the molecular formula C9H13N7OS and a molecular weight of 267.32 g/mol. Its IUPAC name is 1-[2-(1-methylimidazol-2-yl)sulfanylethyl]triazole-4-carbohydrazide.
| Compound Name | 1-[2-(1-methylimidazol-2-yl)sulfanylethyl]triazole-4-carbohydrazide |
|---|---|
| PubChem CID | 63581139 |
| Molecular Formula | C9H13N7OS |
| Molecular Weight | 267.32 g/mol |
| Exact Mass | 267.09 |
| IUPAC Name | 1-[2-(1-methylimidazol-2-yl)sulfanylethyl]triazole-4-carbohydrazide |
| SMILES | Cn1ccnc1SCCn1cc(C(=O)NN)nn1 |
| InChI | InChI=1S/C9H13N7OS/c1-15-3-2-11-9(15)18-5-4-16-6-7(13-14-16)8(17)12-10/h2-3,6H,4-5,10H2,1H3,(H,12,17) |
| InChIKey | LCBVVHHSTPQHRW-UHFFFAOYSA-N |
| XLogP | -0.59 |
| TPSA | 103.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.32 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|