C7H12N4O2S — CID 66339169
hydrazinyl 3-(1-methylimidazol-2-yl)sulfanylpropanoate (PubChem CID 66339169) has the molecular formula C7H12N4O2S and a molecular weight of 216.27 g/mol. Its IUPAC name is hydrazinyl 3-(1-methylimidazol-2-yl)sulfanylpropanoate.
| Compound Name | hydrazinyl 3-(1-methylimidazol-2-yl)sulfanylpropanoate |
|---|---|
| PubChem CID | 66339169 |
| Molecular Formula | C7H12N4O2S |
| Molecular Weight | 216.27 g/mol |
| Exact Mass | 216.07 |
| IUPAC Name | hydrazinyl 3-(1-methylimidazol-2-yl)sulfanylpropanoate |
| SMILES | Cn1ccnc1SCCC(=O)ONN |
| InChI | InChI=1S/C7H12N4O2S/c1-11-4-3-9-7(11)14-5-2-6(12)13-10-8/h3-4,10H,2,5,8H2,1H3 |
| InChIKey | KBPFYDNOTAFSGQ-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 82.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.27 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|