C8H15N5O3S — CID 66336779
hydrazinyl 3-[(5-oxo-4-propan-2-yl-1H-1,2,4-triazol-3-yl)sulfanyl]propanoate (PubChem CID 66336779) has the molecular formula C8H15N5O3S and a molecular weight of 261.31 g/mol. Its IUPAC name is hydrazinyl 3-[(5-oxo-4-propan-2-yl-1H-1,2,4-triazol-3-yl)sulfanyl]propanoate.
| Compound Name | hydrazinyl 3-[(5-oxo-4-propan-2-yl-1H-1,2,4-triazol-3-yl)sulfanyl]propanoate |
|---|---|
| PubChem CID | 66336779 |
| Molecular Formula | C8H15N5O3S |
| Molecular Weight | 261.31 g/mol |
| Exact Mass | 261.09 |
| IUPAC Name | hydrazinyl 3-[(5-oxo-4-propan-2-yl-1H-1,2,4-triazol-3-yl)sulfanyl]propanoate |
| SMILES | CC(C)n1c(SCCC(=O)ONN)n[nH]c1=O |
| InChI | InChI=1S/C8H15N5O3S/c1-5(2)13-7(15)10-11-8(13)17-4-3-6(14)16-12-9/h5,12H,3-4,9H2,1-2H3,(H,10,15) |
| InChIKey | SHFRPNJXVWTOGU-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 115.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.31 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|