C13H26N4OS — CID 106808363
3-[4-(ethylamino)hexylsulfanyl]-4-propan-2-yl-1H-1,2,4-triazol-5-one (PubChem CID 106808363) has the molecular formula C13H26N4OS and a molecular weight of 286.44 g/mol. Its IUPAC name is 3-[4-(ethylamino)hexylsulfanyl]-4-propan-2-yl-1H-1,2,4-triazol-5-one.
| Compound Name | 3-[4-(ethylamino)hexylsulfanyl]-4-propan-2-yl-1H-1,2,4-triazol-5-one |
|---|---|
| PubChem CID | 106808363 |
| Molecular Formula | C13H26N4OS |
| Molecular Weight | 286.44 g/mol |
| Exact Mass | 286.18 |
| IUPAC Name | 3-[4-(ethylamino)hexylsulfanyl]-4-propan-2-yl-1H-1,2,4-triazol-5-one |
| SMILES | CCNC(CC)CCCSc1n[nH]c(=O)n1C(C)C |
| InChI | InChI=1S/C13H26N4OS/c1-5-11(14-6-2)8-7-9-19-13-16-15-12(18)17(13)10(3)4/h10-11,14H,5-9H2,1-4H3,(H,15,18) |
| InChIKey | XDUUPRMIHGBICI-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 62.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.44 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|