C13H24N4O2S — CID 107784492
2-methyl-3-[4-(propylamino)hexylsulfanyl]-1H-1,2,4-triazine-5,6-dione (PubChem CID 107784492) has the molecular formula C13H24N4O2S and a molecular weight of 300.43 g/mol. Its IUPAC name is 2-methyl-3-[4-(propylamino)hexylsulfanyl]-1H-1,2,4-triazine-5,6-dione.
| Compound Name | 2-methyl-3-[4-(propylamino)hexylsulfanyl]-1H-1,2,4-triazine-5,6-dione |
|---|---|
| PubChem CID | 107784492 |
| Molecular Formula | C13H24N4O2S |
| Molecular Weight | 300.43 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | 2-methyl-3-[4-(propylamino)hexylsulfanyl]-1H-1,2,4-triazine-5,6-dione |
| SMILES | CCCNC(CC)CCCSc1nc(=O)c(=O)[nH]n1C |
| InChI | InChI=1S/C13H24N4O2S/c1-4-8-14-10(5-2)7-6-9-20-13-15-11(18)12(19)16-17(13)3/h10,14H,4-9H2,1-3H3,(H,16,19) |
| InChIKey | CSHCBQBMGCOTTR-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 79.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.43 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|