C10H15N3O3S — CID 107786378
2-methyl-3-(4-oxohexylsulfanyl)-1H-1,2,4-triazine-5,6-dione (PubChem CID 107786378) has the molecular formula C10H15N3O3S and a molecular weight of 257.31 g/mol. Its IUPAC name is 2-methyl-3-(4-oxohexylsulfanyl)-1H-1,2,4-triazine-5,6-dione.
| Compound Name | 2-methyl-3-(4-oxohexylsulfanyl)-1H-1,2,4-triazine-5,6-dione |
|---|---|
| PubChem CID | 107786378 |
| Molecular Formula | C10H15N3O3S |
| Molecular Weight | 257.31 g/mol |
| Exact Mass | 257.08 |
| IUPAC Name | 2-methyl-3-(4-oxohexylsulfanyl)-1H-1,2,4-triazine-5,6-dione |
| SMILES | CCC(=O)CCCSc1nc(=O)c(=O)[nH]n1C |
| InChI | InChI=1S/C10H15N3O3S/c1-3-7(14)5-4-6-17-10-11-8(15)9(16)12-13(10)2/h3-6H2,1-2H3,(H,12,16) |
| InChIKey | FVUVUGCAYWZINS-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 84.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.31 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|