C12H20N4O4S — CID 107786611
methyl 2-methyl-2-(methylamino)-5-[(2-methyl-5,6-dioxo-1H-1,2,4-triazin-3-yl)sulfanyl]pentanoate (PubChem CID 107786611) has the molecular formula C12H20N4O4S and a molecular weight of 316.38 g/mol. Its IUPAC name is methyl 2-methyl-2-(methylamino)-5-[(2-methyl-5,6-dioxo-1H-1,2,4-triazin-3-yl)sulfanyl]pentanoate.
| Compound Name | methyl 2-methyl-2-(methylamino)-5-[(2-methyl-5,6-dioxo-1H-1,2,4-triazin-3-yl)sulfanyl]pentanoate |
|---|---|
| PubChem CID | 107786611 |
| Molecular Formula | C12H20N4O4S |
| Molecular Weight | 316.38 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | methyl 2-methyl-2-(methylamino)-5-[(2-methyl-5,6-dioxo-1H-1,2,4-triazin-3-yl)sulfanyl]pentanoate |
| SMILES | CNC(C)(CCCSc1nc(=O)c(=O)[nH]n1C)C(=O)OC |
| InChI | InChI=1S/C12H20N4O4S/c1-12(13-2,10(19)20-4)6-5-7-21-11-14-8(17)9(18)15-16(11)3/h13H,5-7H2,1-4H3,(H,15,18) |
| InChIKey | WUKFKLRQOFFYOV-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 106.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.38 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|