C10H16N4O4S — CID 114001504
2-methyl-2-(methylamino)-4-[(2-methyl-5,6-dioxo-1H-1,2,4-triazin-3-yl)sulfanyl]butanoic acid (PubChem CID 114001504) has the molecular formula C10H16N4O4S and a molecular weight of 288.33 g/mol. Its IUPAC name is 2-methyl-2-(methylamino)-4-[(2-methyl-5,6-dioxo-1H-1,2,4-triazin-3-yl)sulfanyl]butanoic acid.
| Compound Name | 2-methyl-2-(methylamino)-4-[(2-methyl-5,6-dioxo-1H-1,2,4-triazin-3-yl)sulfanyl]butanoic acid |
|---|---|
| PubChem CID | 114001504 |
| Molecular Formula | C10H16N4O4S |
| Molecular Weight | 288.33 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | 2-methyl-2-(methylamino)-4-[(2-methyl-5,6-dioxo-1H-1,2,4-triazin-3-yl)sulfanyl]butanoic acid |
| SMILES | CNC(C)(CCSc1nc(=O)c(=O)[nH]n1C)C(=O)O |
| InChI | InChI=1S/C10H16N4O4S/c1-10(11-2,8(17)18)4-5-19-9-12-6(15)7(16)13-14(9)3/h11H,4-5H2,1-3H3,(H,13,16)(H,17,18) |
| InChIKey | CNXINEXYTSQPBM-UHFFFAOYSA-N |
| XLogP | -0.99 |
| TPSA | 117.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.33 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|