C12H22N4O3S — CID 62884685
methyl 5-[(4-ethyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanyl]-2-methyl-2-(methylamino)pentanoate (PubChem CID 62884685) has the molecular formula C12H22N4O3S and a molecular weight of 302.40 g/mol. Its IUPAC name is methyl 5-[(4-ethyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanyl]-2-methyl-2-(methylamino)pentanoate.
| Compound Name | methyl 5-[(4-ethyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanyl]-2-methyl-2-(methylamino)pentanoate |
|---|---|
| PubChem CID | 62884685 |
| Molecular Formula | C12H22N4O3S |
| Molecular Weight | 302.40 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | methyl 5-[(4-ethyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanyl]-2-methyl-2-(methylamino)pentanoate |
| SMILES | CCn1c(SCCCC(C)(NC)C(=O)OC)n[nH]c1=O |
| InChI | InChI=1S/C12H22N4O3S/c1-5-16-10(18)14-15-11(16)20-8-6-7-12(2,13-3)9(17)19-4/h13H,5-8H2,1-4H3,(H,14,18) |
| InChIKey | SGXABNCIOQJCCC-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 89.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.40 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|