C12H23N5O2S — CID 62882219
2-(ethylamino)-5-[(4-ethyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanyl]-2-methylpentanamide (PubChem CID 62882219) has the molecular formula C12H23N5O2S and a molecular weight of 301.42 g/mol. Its IUPAC name is 2-(ethylamino)-5-[(4-ethyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanyl]-2-methylpentanamide.
| Compound Name | 2-(ethylamino)-5-[(4-ethyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanyl]-2-methylpentanamide |
|---|---|
| PubChem CID | 62882219 |
| Molecular Formula | C12H23N5O2S |
| Molecular Weight | 301.42 g/mol |
| Exact Mass | 301.16 |
| IUPAC Name | 2-(ethylamino)-5-[(4-ethyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanyl]-2-methylpentanamide |
| SMILES | CCNC(C)(CCCSc1n[nH]c(=O)n1CC)C(N)=O |
| InChI | InChI=1S/C12H23N5O2S/c1-4-14-12(3,9(13)18)7-6-8-20-11-16-15-10(19)17(11)5-2/h14H,4-8H2,1-3H3,(H2,13,18)(H,15,19) |
| InChIKey | IHORMHJITCLMJA-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 105.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.42 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|