C13H24BrN3OS — CID 105343474
3-(9-bromononylsulfanyl)-4-ethyl-1H-1,2,4-triazol-5-one (PubChem CID 105343474) has the molecular formula C13H24BrN3OS and a molecular weight of 350.33 g/mol. Its IUPAC name is 3-(9-bromononylsulfanyl)-4-ethyl-1H-1,2,4-triazol-5-one.
| Compound Name | 3-(9-bromononylsulfanyl)-4-ethyl-1H-1,2,4-triazol-5-one |
|---|---|
| PubChem CID | 105343474 |
| Molecular Formula | C13H24BrN3OS |
| Molecular Weight | 350.33 g/mol |
| Exact Mass | 349.08 |
| IUPAC Name | 3-(9-bromononylsulfanyl)-4-ethyl-1H-1,2,4-triazol-5-one |
| SMILES | CCn1c(SCCCCCCCCCBr)n[nH]c1=O |
| InChI | InChI=1S/C13H24BrN3OS/c1-2-17-12(18)15-16-13(17)19-11-9-7-5-3-4-6-8-10-14/h2-11H2,1H3,(H,15,18) |
| InChIKey | RLFIMFSHUDMNOF-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 50.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.33 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|