C13H21N5O2S — CID 107786559
2-ethyl-2-(ethylamino)-5-[(2-methyl-5,6-dioxo-1H-1,2,4-triazin-3-yl)sulfanyl]pentanenitrile (PubChem CID 107786559) has the molecular formula C13H21N5O2S and a molecular weight of 311.41 g/mol. Its IUPAC name is 2-ethyl-2-(ethylamino)-5-[(2-methyl-5,6-dioxo-1H-1,2,4-triazin-3-yl)sulfanyl]pentanenitrile.
| Compound Name | 2-ethyl-2-(ethylamino)-5-[(2-methyl-5,6-dioxo-1H-1,2,4-triazin-3-yl)sulfanyl]pentanenitrile |
|---|---|
| PubChem CID | 107786559 |
| Molecular Formula | C13H21N5O2S |
| Molecular Weight | 311.41 g/mol |
| Exact Mass | 311.14 |
| IUPAC Name | 2-ethyl-2-(ethylamino)-5-[(2-methyl-5,6-dioxo-1H-1,2,4-triazin-3-yl)sulfanyl]pentanenitrile |
| SMILES | CCNC(C#N)(CC)CCCSc1nc(=O)c(=O)[nH]n1C |
| InChI | InChI=1S/C13H21N5O2S/c1-4-13(9-14,15-5-2)7-6-8-21-12-16-10(19)11(20)17-18(12)3/h15H,4-8H2,1-3H3,(H,17,20) |
| InChIKey | XTSKIVOORPINFU-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 103.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.41 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|