C14H25N5OS — CID 106805377
2-ethyl-2-(ethylamino)-5-[(5-oxo-4-propyl-1H-1,2,4-triazol-3-yl)sulfanyl]pentanenitrile (PubChem CID 106805377) has the molecular formula C14H25N5OS and a molecular weight of 311.46 g/mol. Its IUPAC name is 2-ethyl-2-(ethylamino)-5-[(5-oxo-4-propyl-1H-1,2,4-triazol-3-yl)sulfanyl]pentanenitrile.
| Compound Name | 2-ethyl-2-(ethylamino)-5-[(5-oxo-4-propyl-1H-1,2,4-triazol-3-yl)sulfanyl]pentanenitrile |
|---|---|
| PubChem CID | 106805377 |
| Molecular Formula | C14H25N5OS |
| Molecular Weight | 311.46 g/mol |
| Exact Mass | 311.18 |
| IUPAC Name | 2-ethyl-2-(ethylamino)-5-[(5-oxo-4-propyl-1H-1,2,4-triazol-3-yl)sulfanyl]pentanenitrile |
| SMILES | CCCn1c(SCCCC(C#N)(CC)NCC)n[nH]c1=O |
| InChI | InChI=1S/C14H25N5OS/c1-4-9-19-12(20)17-18-13(19)21-10-7-8-14(5-2,11-15)16-6-3/h16H,4-10H2,1-3H3,(H,17,20) |
| InChIKey | HQPAZDKYRCDROB-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 86.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.46 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|