About 4-[(5-oxo-4-propyl-1H-1,2,4-triazol-3-yl)sulfanyl]butanenitrile
4-[(5-oxo-4-propyl-1H-1,2,4-triazol-3-yl)sulfanyl]butanenitrile (PubChem CID 8626684) has the molecular formula C9H14N4OS
and a molecular weight of 226.30 g/mol. Its IUPAC name is 4-[(5-oxo-4-propyl-1H-1,2,4-triazol-3-yl)sulfanyl]butanenitrile.
Molecular Properties
| Compound Name | 4-[(5-oxo-4-propyl-1H-1,2,4-triazol-3-yl)sulfanyl]butanenitrile |
| PubChem CID | 8626684 |
| Molecular Formula | C9H14N4OS |
| Molecular Weight | 226.30 g/mol |
| Exact Mass | 226.09 |
| IUPAC Name | 4-[(5-oxo-4-propyl-1H-1,2,4-triazol-3-yl)sulfanyl]butanenitrile |
| SMILES | CCCn1c(SCCCC#N)n[nH]c1=O |
| InChI | InChI=1S/C9H14N4OS/c1-2-6-13-8(14)11-12-9(13)15-7-4-3-5-10/h2-4,6-7H2,1H3,(H,11,14) |
| InChIKey | BFFRNBQSWHLTRH-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 74.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.30 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-[(5-oxo-4-propyl-1H-1,2,4-triazol-3-yl)sulfanyl]butanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(5-oxo-4-propyl-1H-1,2,4-triazol-3-yl)sulfanyl]butanenitrile?
The IUPAC name of 4-[(5-oxo-4-propyl-1H-1,2,4-triazol-3-yl)sulfanyl]butanenitrile (CID 8626684) is 4-[(5-oxo-4-propyl-1H-1,2,4-triazol-3-yl)sulfanyl]butanenitrile.
What is the SMILES notation for 4-[(5-oxo-4-propyl-1H-1,2,4-triazol-3-yl)sulfanyl]butanenitrile?
The canonical SMILES for 4-[(5-oxo-4-propyl-1H-1,2,4-triazol-3-yl)sulfanyl]butanenitrile is CCCn1c(SCCCC#N)n[nH]c1=O.
What is the InChIKey of 4-[(5-oxo-4-propyl-1H-1,2,4-triazol-3-yl)sulfanyl]butanenitrile?
The InChIKey is BFFRNBQSWHLTRH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N4OS/c1-2-6-13-8(14)11-12-9(13)15-7-4-3-5-10/h2-4,6-7H2,1H3,(H,11,14).
What are the key properties of 4-[(5-oxo-4-propyl-1H-1,2,4-triazol-3-yl)sulfanyl]butanenitrile?
4-[(5-oxo-4-propyl-1H-1,2,4-triazol-3-yl)sulfanyl]butanenitrile has a molecular weight of 226.30 g/mol, XLogP of 1.38, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(5-oxo-4-propyl-1H-1,2,4-triazol-3-yl)sulfanyl]butanenitrile is sourced from PubChem (CID 8626684), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).