C11H21N3O3S — CID 63630277
3-(2,2-diethoxyethylsulfanyl)-4-propyl-1H-1,2,4-triazol-5-one (PubChem CID 63630277) has the molecular formula C11H21N3O3S and a molecular weight of 275.37 g/mol. Its IUPAC name is 3-(2,2-diethoxyethylsulfanyl)-4-propyl-1H-1,2,4-triazol-5-one.
| Compound Name | 3-(2,2-diethoxyethylsulfanyl)-4-propyl-1H-1,2,4-triazol-5-one |
|---|---|
| PubChem CID | 63630277 |
| Molecular Formula | C11H21N3O3S |
| Molecular Weight | 275.37 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | 3-(2,2-diethoxyethylsulfanyl)-4-propyl-1H-1,2,4-triazol-5-one |
| SMILES | CCCn1c(SCC(OCC)OCC)n[nH]c1=O |
| InChI | InChI=1S/C11H21N3O3S/c1-4-7-14-10(15)12-13-11(14)18-8-9(16-5-2)17-6-3/h9H,4-8H2,1-3H3,(H,12,15) |
| InChIKey | OLVPYUOHGPZSLL-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 69.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.37 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|