C10H17N3O2S — CID 62883784
3-(2-oxopentylsulfanyl)-4-propyl-1H-1,2,4-triazol-5-one (PubChem CID 62883784) has the molecular formula C10H17N3O2S and a molecular weight of 243.33 g/mol. Its IUPAC name is 3-(2-oxopentylsulfanyl)-4-propyl-1H-1,2,4-triazol-5-one.
| Compound Name | 3-(2-oxopentylsulfanyl)-4-propyl-1H-1,2,4-triazol-5-one |
|---|---|
| PubChem CID | 62883784 |
| Molecular Formula | C10H17N3O2S |
| Molecular Weight | 243.33 g/mol |
| Exact Mass | 243.10 |
| IUPAC Name | 3-(2-oxopentylsulfanyl)-4-propyl-1H-1,2,4-triazol-5-one |
| SMILES | CCCC(=O)CSc1n[nH]c(=O)n1CCC |
| InChI | InChI=1S/C10H17N3O2S/c1-3-5-8(14)7-16-10-12-11-9(15)13(10)6-4-2/h3-7H2,1-2H3,(H,11,15) |
| InChIKey | SXGQLMOTBVEQSI-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 67.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.33 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |