C7H13N5O2S — CID 76873092
N'-hydroxy-2-[(5-oxo-4-propyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethanimidamide (PubChem CID 76873092) has the molecular formula C7H13N5O2S and a molecular weight of 231.28 g/mol. Its IUPAC name is N'-hydroxy-2-[(5-oxo-4-propyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethanimidamide.
| Compound Name | N'-hydroxy-2-[(5-oxo-4-propyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethanimidamide |
|---|---|
| PubChem CID | 76873092 |
| Molecular Formula | C7H13N5O2S |
| Molecular Weight | 231.28 g/mol |
| Exact Mass | 231.08 |
| IUPAC Name | N'-hydroxy-2-[(5-oxo-4-propyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethanimidamide |
| SMILES | CCCn1c(SCC(N)=NO)n[nH]c1=O |
| InChI | InChI=1S/C7H13N5O2S/c1-2-3-12-6(13)9-10-7(12)15-4-5(8)11-14/h14H,2-4H2,1H3,(H2,8,11)(H,9,13) |
| InChIKey | UWSVGMAFTOTIAU-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 109.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.28 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|