C10H21N3OSSi — CID 56529312
4-butyl-3-(trimethylsilylmethylsulfanyl)-1H-1,2,4-triazol-5-one (PubChem CID 56529312) has the molecular formula C10H21N3OSSi and a molecular weight of 259.45 g/mol. Its IUPAC name is 4-butyl-3-(trimethylsilylmethylsulfanyl)-1H-1,2,4-triazol-5-one.
| Compound Name | 4-butyl-3-(trimethylsilylmethylsulfanyl)-1H-1,2,4-triazol-5-one |
|---|---|
| PubChem CID | 56529312 |
| Molecular Formula | C10H21N3OSSi |
| Molecular Weight | 259.45 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | 4-butyl-3-(trimethylsilylmethylsulfanyl)-1H-1,2,4-triazol-5-one |
| SMILES | CCCCn1c(SC[Si](C)(C)C)n[nH]c1=O |
| InChI | InChI=1S/C10H21N3OSSi/c1-5-6-7-13-9(14)11-12-10(13)15-8-16(2,3)4/h5-8H2,1-4H3,(H,11,14) |
| InChIKey | ZGLHCVBVTGACMY-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 50.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.45 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|