C12H20N4O2S — CID 42895521
3-[(4-butyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanyl]azepan-2-one (PubChem CID 42895521) has the molecular formula C12H20N4O2S and a molecular weight of 284.38 g/mol. Its IUPAC name is 3-[(4-butyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanyl]azepan-2-one.
| Compound Name | 3-[(4-butyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanyl]azepan-2-one |
|---|---|
| PubChem CID | 42895521 |
| Molecular Formula | C12H20N4O2S |
| Molecular Weight | 284.38 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | 3-[(4-butyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanyl]azepan-2-one |
| SMILES | CCCCn1c(SC2CCCCNC2=O)n[nH]c1=O |
| InChI | InChI=1S/C12H20N4O2S/c1-2-3-8-16-11(18)14-15-12(16)19-9-6-4-5-7-13-10(9)17/h9H,2-8H2,1H3,(H,13,17)(H,14,18) |
| InChIKey | WTRMEFMRJVYTNU-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 79.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.38 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |