C21H29N3O2S2 — CID 24597170
2-(2-oxoazepan-3-yl)sulfanyl-3-pentyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one (PubChem CID 24597170) has the molecular formula C21H29N3O2S2 and a molecular weight of 419.62 g/mol. Its IUPAC name is 2-(2-oxoazepan-3-yl)sulfanyl-3-pentyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one.
| Compound Name | 2-(2-oxoazepan-3-yl)sulfanyl-3-pentyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 24597170 |
| Molecular Formula | C21H29N3O2S2 |
| Molecular Weight | 419.62 g/mol |
| Exact Mass | 419.17 |
| IUPAC Name | 2-(2-oxoazepan-3-yl)sulfanyl-3-pentyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one |
| SMILES | CCCCCn1c(SC2CCCCNC2=O)nc2sc3c(c2c1=O)CCCC3 |
| InChI | InChI=1S/C21H29N3O2S2/c1-2-3-8-13-24-20(26)17-14-9-4-5-10-15(14)27-19(17)23-21(24)28-16-11-6-7-12-22-18(16)25/h16H,2-13H2,1H3,(H,22,25) |
| InChIKey | KJBRREXPIPGXQP-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.62 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|