C15H18N4O2S — CID 17482311
4-[2-[(4-butyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanyl]ethoxy]benzonitrile (PubChem CID 17482311) has the molecular formula C15H18N4O2S and a molecular weight of 318.40 g/mol. Its IUPAC name is 4-[2-[(4-butyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanyl]ethoxy]benzonitrile.
| Compound Name | 4-[2-[(4-butyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanyl]ethoxy]benzonitrile |
|---|---|
| PubChem CID | 17482311 |
| Molecular Formula | C15H18N4O2S |
| Molecular Weight | 318.40 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | 4-[2-[(4-butyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanyl]ethoxy]benzonitrile |
| SMILES | CCCCn1c(SCCOc2ccc(C#N)cc2)n[nH]c1=O |
| InChI | InChI=1S/C15H18N4O2S/c1-2-3-8-19-14(20)17-18-15(19)22-10-9-21-13-6-4-12(11-16)5-7-13/h4-7H,2-3,8-10H2,1H3,(H,17,20) |
| InChIKey | XFQALYKJHCWCJS-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 83.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.40 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|