C13H14N4OS — CID 104588387
4-[3-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]propoxy]benzonitrile (PubChem CID 104588387) has the molecular formula C13H14N4OS and a molecular weight of 274.35 g/mol. Its IUPAC name is 4-[3-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]propoxy]benzonitrile.
| Compound Name | 4-[3-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]propoxy]benzonitrile |
|---|---|
| PubChem CID | 104588387 |
| Molecular Formula | C13H14N4OS |
| Molecular Weight | 274.35 g/mol |
| Exact Mass | 274.09 |
| IUPAC Name | 4-[3-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]propoxy]benzonitrile |
| SMILES | Cn1ncnc1SCCCOc1ccc(C#N)cc1 |
| InChI | InChI=1S/C13H14N4OS/c1-17-13(15-10-16-17)19-8-2-7-18-12-5-3-11(9-14)4-6-12/h3-6,10H,2,7-8H2,1H3 |
| InChIKey | HDOXDGOCMARAQI-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 63.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.35 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|